C21H26N2O2S — CID 131905750
5-oxo-5-phenyl-N-[1-(thiophen-2-ylmethyl)piperidin-3-yl]pentanamide (PubChem CID 131905750) has the molecular formula C21H26N2O2S and a molecular weight of 370.52 g/mol. Its IUPAC name is 5-oxo-5-phenyl-N-[1-(thiophen-2-ylmethyl)piperidin-3-yl]pentanamide.
| Compound Name | 5-oxo-5-phenyl-N-[1-(thiophen-2-ylmethyl)piperidin-3-yl]pentanamide |
|---|---|
| PubChem CID | 131905750 |
| Molecular Formula | C21H26N2O2S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 5-oxo-5-phenyl-N-[1-(thiophen-2-ylmethyl)piperidin-3-yl]pentanamide |
| SMILES | O=C(CCCC(=O)c1ccccc1)NC1CCCN(Cc2cccs2)C1 |
| InChI | InChI=1S/C21H26N2O2S/c24-20(17-7-2-1-3-8-17)11-4-12-21(25)22-18-9-5-13-23(15-18)16-19-10-6-14-26-19/h1-3,6-8,10,14,18H,4-5,9,11-13,15-16H2,(H,22,25) |
| InChIKey | ZWUGRHQVECDKBY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |