C14H23N3O3S2 — CID 131929491
4-sulfamoyl-N-[1-(thiophen-2-ylmethyl)piperidin-3-yl]butanamide (PubChem CID 131929491) has the molecular formula C14H23N3O3S2 and a molecular weight of 345.49 g/mol. Its IUPAC name is 4-sulfamoyl-N-[1-(thiophen-2-ylmethyl)piperidin-3-yl]butanamide.
| Compound Name | 4-sulfamoyl-N-[1-(thiophen-2-ylmethyl)piperidin-3-yl]butanamide |
|---|---|
| PubChem CID | 131929491 |
| Molecular Formula | C14H23N3O3S2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 4-sulfamoyl-N-[1-(thiophen-2-ylmethyl)piperidin-3-yl]butanamide |
| SMILES | NS(=O)(=O)CCCC(=O)NC1CCCN(Cc2cccs2)C1 |
| InChI | InChI=1S/C14H23N3O3S2/c15-22(19,20)9-3-6-14(18)16-12-4-1-7-17(10-12)11-13-5-2-8-21-13/h2,5,8,12H,1,3-4,6-7,9-11H2,(H,16,18)(H2,15,19,20) |
| InChIKey | KNADXQYAUVTVFV-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |