C13H18N4O2S2 — CID 131904796
N-[1-(thiophen-2-ylmethyl)piperidin-3-yl]-1H-pyrazole-4-sulfonamide (PubChem CID 131904796) has the molecular formula C13H18N4O2S2 and a molecular weight of 326.45 g/mol. Its IUPAC name is N-[1-(thiophen-2-ylmethyl)piperidin-3-yl]-1H-pyrazole-4-sulfonamide.
| Compound Name | N-[1-(thiophen-2-ylmethyl)piperidin-3-yl]-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 131904796 |
| Molecular Formula | C13H18N4O2S2 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | N-[1-(thiophen-2-ylmethyl)piperidin-3-yl]-1H-pyrazole-4-sulfonamide |
| SMILES | O=S(=O)(NC1CCCN(Cc2cccs2)C1)c1cn[nH]c1 |
| InChI | InChI=1S/C13H18N4O2S2/c18-21(19,13-7-14-15-8-13)16-11-3-1-5-17(9-11)10-12-4-2-6-20-12/h2,4,6-8,11,16H,1,3,5,9-10H2,(H,14,15) |
| InChIKey | HQRWMEIYSGIOQD-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |