C17H20F2N2O3S2 — CID 131935000
4-(difluoromethoxy)-N-[1-(thiophen-2-ylmethyl)piperidin-3-yl]benzenesulfonamide (PubChem CID 131935000) has the molecular formula C17H20F2N2O3S2 and a molecular weight of 402.49 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-[1-(thiophen-2-ylmethyl)piperidin-3-yl]benzenesulfonamide.
| Compound Name | 4-(difluoromethoxy)-N-[1-(thiophen-2-ylmethyl)piperidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 131935000 |
| Molecular Formula | C17H20F2N2O3S2 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 4-(difluoromethoxy)-N-[1-(thiophen-2-ylmethyl)piperidin-3-yl]benzenesulfonamide |
| SMILES | O=S(=O)(NC1CCCN(Cc2cccs2)C1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C17H20F2N2O3S2/c18-17(19)24-14-5-7-16(8-6-14)26(22,23)20-13-3-1-9-21(11-13)12-15-4-2-10-25-15/h2,4-8,10,13,17,20H,1,3,9,11-12H2 |
| InChIKey | LPLJKOSNUQDTRA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |