C12H18ClNS — CID 63388568
3-(2-chloroethyl)-1-(thiophen-2-ylmethyl)piperidine (PubChem CID 63388568) has the molecular formula C12H18ClNS and a molecular weight of 243.80 g/mol. Its IUPAC name is 3-(2-chloroethyl)-1-(thiophen-2-ylmethyl)piperidine.
| Compound Name | 3-(2-chloroethyl)-1-(thiophen-2-ylmethyl)piperidine |
|---|---|
| PubChem CID | 63388568 |
| Molecular Formula | C12H18ClNS |
| Molecular Weight | 243.80 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 3-(2-chloroethyl)-1-(thiophen-2-ylmethyl)piperidine |
| SMILES | ClCCC1CCCN(Cc2cccs2)C1 |
| InChI | InChI=1S/C12H18ClNS/c13-6-5-11-3-1-7-14(9-11)10-12-4-2-8-15-12/h2,4,8,11H,1,3,5-7,9-10H2 |
| InChIKey | OPSVUZWOMZZFCH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.80 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|