C24H33N3OS — CID 49214275
1-benzyl-N-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]piperidine-3-carboxamide (PubChem CID 49214275) has the molecular formula C24H33N3OS and a molecular weight of 411.62 g/mol. Its IUPAC name is 1-benzyl-N-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]piperidine-3-carboxamide.
| Compound Name | 1-benzyl-N-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 49214275 |
| Molecular Formula | C24H33N3OS |
| Molecular Weight | 411.62 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 1-benzyl-N-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]piperidine-3-carboxamide |
| SMILES | O=C(NCC1CCCN(Cc2cccs2)C1)C1CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C24H33N3OS/c28-24(22-10-5-13-26(18-22)16-20-7-2-1-3-8-20)25-15-21-9-4-12-27(17-21)19-23-11-6-14-29-23/h1-3,6-8,11,14,21-22H,4-5,9-10,12-13,15-19H2,(H,25,28) |
| InChIKey | ZUHRIOFBCWDMPL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.62 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |