C20H28N2O — CID 47082202
N-[(1-benzylpiperidin-3-yl)methyl]cyclohex-3-ene-1-carboxamide (PubChem CID 47082202) has the molecular formula C20H28N2O and a molecular weight of 312.46 g/mol. Its IUPAC name is N-[(1-benzylpiperidin-3-yl)methyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | N-[(1-benzylpiperidin-3-yl)methyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 47082202 |
| Molecular Formula | C20H28N2O |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | N-[(1-benzylpiperidin-3-yl)methyl]cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(NCC1CCCN(Cc2ccccc2)C1)C1CC=CCC1 |
| InChI | InChI=1S/C20H28N2O/c23-20(19-11-5-2-6-12-19)21-14-18-10-7-13-22(16-18)15-17-8-3-1-4-9-17/h1-5,8-9,18-19H,6-7,10-16H2,(H,21,23) |
| InChIKey | TUADSHGSRJLZLJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|