C14H23N3O2S — CID 49280156
1-(2-hydroxyethyl)-3-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]urea (PubChem CID 49280156) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]urea.
| Compound Name | 1-(2-hydroxyethyl)-3-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]urea |
|---|---|
| PubChem CID | 49280156 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]urea |
| SMILES | O=C(NCCO)NCC1CCCN(Cc2cccs2)C1 |
| InChI | InChI=1S/C14H23N3O2S/c18-7-5-15-14(19)16-9-12-3-1-6-17(10-12)11-13-4-2-8-20-13/h2,4,8,12,18H,1,3,5-7,9-11H2,(H2,15,16,19) |
| InChIKey | QYWFGDYIOHZEHG-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |