C16H26N2OS2 — CID 94819206
2-propylsulfanyl-N-[[(3S)-1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]acetamide (PubChem CID 94819206) has the molecular formula C16H26N2OS2 and a molecular weight of 326.53 g/mol. Its IUPAC name is 2-propylsulfanyl-N-[[(3S)-1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]acetamide.
| Compound Name | 2-propylsulfanyl-N-[[(3S)-1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 94819206 |
| Molecular Formula | C16H26N2OS2 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 2-propylsulfanyl-N-[[(3S)-1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]acetamide |
| SMILES | CCCSCC(=O)NC[C@@H]1CCCN(Cc2cccs2)C1 |
| InChI | InChI=1S/C16H26N2OS2/c1-2-8-20-13-16(19)17-10-14-5-3-7-18(11-14)12-15-6-4-9-21-15/h4,6,9,14H,2-3,5,7-8,10-13H2,1H3,(H,17,19)/t14-/m0/s1 |
| InChIKey | MSEKYFMSFIMLRM-AWEZNQCLSA-N |
| XLogP | 3.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|