C17H26N2OS — CID 94819121
N-[[(3S)-1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]cyclopentanecarboxamide (PubChem CID 94819121) has the molecular formula C17H26N2OS and a molecular weight of 306.47 g/mol. Its IUPAC name is N-[[(3S)-1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]cyclopentanecarboxamide.
| Compound Name | N-[[(3S)-1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 94819121 |
| Molecular Formula | C17H26N2OS |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | N-[[(3S)-1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]cyclopentanecarboxamide |
| SMILES | O=C(NC[C@@H]1CCCN(Cc2cccs2)C1)C1CCCC1 |
| InChI | InChI=1S/C17H26N2OS/c20-17(15-6-1-2-7-15)18-11-14-5-3-9-19(12-14)13-16-8-4-10-21-16/h4,8,10,14-15H,1-3,5-7,9,11-13H2,(H,18,20)/t14-/m0/s1 |
| InChIKey | YRPUNRRKEFBWJA-AWEZNQCLSA-N |
| XLogP | 3.27 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |