C16H25N3O2S — CID 119865355
N-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]morpholine-3-carboxamide (PubChem CID 119865355) has the molecular formula C16H25N3O2S and a molecular weight of 323.46 g/mol. Its IUPAC name is N-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]morpholine-3-carboxamide.
| Compound Name | N-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 119865355 |
| Molecular Formula | C16H25N3O2S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | N-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]morpholine-3-carboxamide |
| SMILES | O=C(NCC1CCCN(Cc2cccs2)C1)C1COCCN1 |
| InChI | InChI=1S/C16H25N3O2S/c20-16(15-12-21-7-5-17-15)18-9-13-3-1-6-19(10-13)11-14-4-2-8-22-14/h2,4,8,13,15,17H,1,3,5-7,9-12H2,(H,18,20) |
| InChIKey | BKTMGWRJHRRCMV-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |