C19H24N2O2S — CID 122030782
3-[[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methylamino]methyl]benzoic acid (PubChem CID 122030782) has the molecular formula C19H24N2O2S and a molecular weight of 344.48 g/mol. Its IUPAC name is 3-[[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methylamino]methyl]benzoic acid.
| Compound Name | 3-[[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122030782 |
| Molecular Formula | C19H24N2O2S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 3-[[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methylamino]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CNCC2CCCN(Cc3cccs3)C2)c1 |
| InChI | InChI=1S/C19H24N2O2S/c22-19(23)17-6-1-4-15(10-17)11-20-12-16-5-2-8-21(13-16)14-18-7-3-9-24-18/h1,3-4,6-7,9-10,16,20H,2,5,8,11-14H2,(H,22,23) |
| InChIKey | XTVYFDAPCYDJDU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |