C13H23ClN2S — CID 115597499
1-(1-ethylpiperidin-3-yl)-N-(thiophen-2-ylmethyl)methanamine;hydrochloride (PubChem CID 115597499) has the molecular formula C13H23ClN2S and a molecular weight of 274.86 g/mol. Its IUPAC name is 1-(1-ethylpiperidin-3-yl)-N-(thiophen-2-ylmethyl)methanamine;hydrochloride.
| Compound Name | 1-(1-ethylpiperidin-3-yl)-N-(thiophen-2-ylmethyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 115597499 |
| Molecular Formula | C13H23ClN2S |
| Molecular Weight | 274.86 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 1-(1-ethylpiperidin-3-yl)-N-(thiophen-2-ylmethyl)methanamine;hydrochloride |
| SMILES | CCN1CCCC(CNCc2cccs2)C1.Cl |
| InChI | InChI=1S/C13H22N2S.ClH/c1-2-15-7-3-5-12(11-15)9-14-10-13-6-4-8-16-13;/h4,6,8,12,14H,2-3,5,7,9-11H2,1H3;1H |
| InChIKey | ILEWIOALQYDPRG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.86 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |