C14H22N2O4S — CID 17053126
1-(1-ethylpyrrolidin-2-yl)-N-(thiophen-2-ylmethyl)methanamine;oxalic acid (PubChem CID 17053126) has the molecular formula C14H22N2O4S and a molecular weight of 314.41 g/mol. Its IUPAC name is 1-(1-ethylpyrrolidin-2-yl)-N-(thiophen-2-ylmethyl)methanamine;oxalic acid.
| Compound Name | 1-(1-ethylpyrrolidin-2-yl)-N-(thiophen-2-ylmethyl)methanamine;oxalic acid |
|---|---|
| PubChem CID | 17053126 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 1-(1-ethylpyrrolidin-2-yl)-N-(thiophen-2-ylmethyl)methanamine;oxalic acid |
| SMILES | CCN1CCCC1CNCc1cccs1.O=C(O)C(=O)O |
| InChI | InChI=1S/C12H20N2S.C2H2O4/c1-2-14-7-3-5-11(14)9-13-10-12-6-4-8-15-12;3-1(4)2(5)6/h4,6,8,11,13H,2-3,5,7,9-10H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | OBOKLKWFUZXXFB-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|