C12H17NOS — CID 79546734
1-[1-(thiophen-2-ylmethyl)pyrrolidin-2-yl]propan-2-one (PubChem CID 79546734) has the molecular formula C12H17NOS and a molecular weight of 223.34 g/mol. Its IUPAC name is 1-[1-(thiophen-2-ylmethyl)pyrrolidin-2-yl]propan-2-one.
| Compound Name | 1-[1-(thiophen-2-ylmethyl)pyrrolidin-2-yl]propan-2-one |
|---|---|
| PubChem CID | 79546734 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 1-[1-(thiophen-2-ylmethyl)pyrrolidin-2-yl]propan-2-one |
| SMILES | CC(=O)CC1CCCN1Cc1cccs1 |
| InChI | InChI=1S/C12H17NOS/c1-10(14)8-11-4-2-6-13(11)9-12-5-3-7-15-12/h3,5,7,11H,2,4,6,8-9H2,1H3 |
| InChIKey | JRDPUBUJZFUGTQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |