C14H24N2S — CID 62580578
N-[[1-(thiophen-2-ylmethyl)piperidin-2-yl]methyl]propan-1-amine (PubChem CID 62580578) has the molecular formula C14H24N2S and a molecular weight of 252.43 g/mol. Its IUPAC name is N-[[1-(thiophen-2-ylmethyl)piperidin-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-(thiophen-2-ylmethyl)piperidin-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 62580578 |
| Molecular Formula | C14H24N2S |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | N-[[1-(thiophen-2-ylmethyl)piperidin-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCC1CCCCN1Cc1cccs1 |
| InChI | InChI=1S/C14H24N2S/c1-2-8-15-11-13-6-3-4-9-16(13)12-14-7-5-10-17-14/h5,7,10,13,15H,2-4,6,8-9,11-12H2,1H3 |
| InChIKey | ZWGOHVNVVDMHGO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|