C15H24Cl2N2O2 — CID 17215973
2-[[(1-ethylpyrrolidin-2-yl)methylamino]methyl]benzoic acid;dihydrochloride (PubChem CID 17215973) has the molecular formula C15H24Cl2N2O2 and a molecular weight of 335.28 g/mol. Its IUPAC name is 2-[[(1-ethylpyrrolidin-2-yl)methylamino]methyl]benzoic acid;dihydrochloride.
| Compound Name | 2-[[(1-ethylpyrrolidin-2-yl)methylamino]methyl]benzoic acid;dihydrochloride |
|---|---|
| PubChem CID | 17215973 |
| Molecular Formula | C15H24Cl2N2O2 |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 2-[[(1-ethylpyrrolidin-2-yl)methylamino]methyl]benzoic acid;dihydrochloride |
| SMILES | CCN1CCCC1CNCc1ccccc1C(=O)O.Cl.Cl |
| InChI | InChI=1S/C15H22N2O2.2ClH/c1-2-17-9-5-7-13(17)11-16-10-12-6-3-4-8-14(12)15(18)19;;/h3-4,6,8,13,16H,2,5,7,9-11H2,1H3,(H,18,19);2*1H |
| InChIKey | HVERSBYVKWHLGU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |