C25H31N3O2 — CID 6625254
3-[[(1-ethylpyrrolidin-2-yl)methylamino]methyl]-1-[(2-methylphenyl)methyl]indole-2-carboxylic acid (PubChem CID 6625254) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is 3-[[(1-ethylpyrrolidin-2-yl)methylamino]methyl]-1-[(2-methylphenyl)methyl]indole-2-carboxylic acid.
| Compound Name | 3-[[(1-ethylpyrrolidin-2-yl)methylamino]methyl]-1-[(2-methylphenyl)methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 6625254 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 3-[[(1-ethylpyrrolidin-2-yl)methylamino]methyl]-1-[(2-methylphenyl)methyl]indole-2-carboxylic acid |
| SMILES | CCN1CCCC1CNCc1c(C(=O)O)n(Cc2ccccc2C)c2ccccc12 |
| InChI | InChI=1S/C25H31N3O2/c1-3-27-14-8-11-20(27)15-26-16-22-21-12-6-7-13-23(21)28(24(22)25(29)30)17-19-10-5-4-9-18(19)2/h4-7,9-10,12-13,20,26H,3,8,11,14-17H2,1-2H3,(H,29,30) |
| InChIKey | CKUNWMFPYKPPHN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|