C28H27N3O2 — CID 53207064
3-[[2-(1H-indol-3-yl)ethylamino]methyl]-1-[(2-methylphenyl)methyl]indole-2-carboxylic acid (PubChem CID 53207064) has the molecular formula C28H27N3O2 and a molecular weight of 437.54 g/mol. Its IUPAC name is 3-[[2-(1H-indol-3-yl)ethylamino]methyl]-1-[(2-methylphenyl)methyl]indole-2-carboxylic acid.
| Compound Name | 3-[[2-(1H-indol-3-yl)ethylamino]methyl]-1-[(2-methylphenyl)methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 53207064 |
| Molecular Formula | C28H27N3O2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 3-[[2-(1H-indol-3-yl)ethylamino]methyl]-1-[(2-methylphenyl)methyl]indole-2-carboxylic acid |
| SMILES | Cc1ccccc1Cn1c(C(=O)O)c(CNCCc2c[nH]c3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C28H27N3O2/c1-19-8-2-3-9-21(19)18-31-26-13-7-5-11-23(26)24(27(31)28(32)33)17-29-15-14-20-16-30-25-12-6-4-10-22(20)25/h2-13,16,29-30H,14-15,17-18H2,1H3,(H,32,33) |
| InChIKey | FQDBVYMUOXDLJA-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 70.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|