C25H32N2O3 — CID 53207096
1-[(2,5-dimethylphenyl)methyl]-3-[(3-propan-2-yloxypropylamino)methyl]indole-2-carboxylic acid (PubChem CID 53207096) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is 1-[(2,5-dimethylphenyl)methyl]-3-[(3-propan-2-yloxypropylamino)methyl]indole-2-carboxylic acid.
| Compound Name | 1-[(2,5-dimethylphenyl)methyl]-3-[(3-propan-2-yloxypropylamino)methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 53207096 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | 1-[(2,5-dimethylphenyl)methyl]-3-[(3-propan-2-yloxypropylamino)methyl]indole-2-carboxylic acid |
| SMILES | Cc1ccc(C)c(Cn2c(C(=O)O)c(CNCCCOC(C)C)c3ccccc32)c1 |
| InChI | InChI=1S/C25H32N2O3/c1-17(2)30-13-7-12-26-15-22-21-8-5-6-9-23(21)27(24(22)25(28)29)16-20-14-18(3)10-11-19(20)4/h5-6,8-11,14,17,26H,7,12-13,15-16H2,1-4H3,(H,28,29) |
| InChIKey | GRJUPLSILOQDBR-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|