C21H24N2O2 — CID 53207032
1-ethyl-3-[(3-phenylpropylamino)methyl]indole-2-carboxylic acid (PubChem CID 53207032) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 1-ethyl-3-[(3-phenylpropylamino)methyl]indole-2-carboxylic acid.
| Compound Name | 1-ethyl-3-[(3-phenylpropylamino)methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 53207032 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 1-ethyl-3-[(3-phenylpropylamino)methyl]indole-2-carboxylic acid |
| SMILES | CCn1c(C(=O)O)c(CNCCCc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C21H24N2O2/c1-2-23-19-13-7-6-12-17(19)18(20(23)21(24)25)15-22-14-8-11-16-9-4-3-5-10-16/h3-7,9-10,12-13,22H,2,8,11,14-15H2,1H3,(H,24,25) |
| InChIKey | HJFDZMDAPCQLRI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|