C20H21FN2O2 — CID 53207040
1-[(2-fluorophenyl)methyl]-3-(propylaminomethyl)indole-2-carboxylic acid (PubChem CID 53207040) has the molecular formula C20H21FN2O2 and a molecular weight of 340.40 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-3-(propylaminomethyl)indole-2-carboxylic acid.
| Compound Name | 1-[(2-fluorophenyl)methyl]-3-(propylaminomethyl)indole-2-carboxylic acid |
|---|---|
| PubChem CID | 53207040 |
| Molecular Formula | C20H21FN2O2 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-3-(propylaminomethyl)indole-2-carboxylic acid |
| SMILES | CCCNCc1c(C(=O)O)n(Cc2ccccc2F)c2ccccc12 |
| InChI | InChI=1S/C20H21FN2O2/c1-2-11-22-12-16-15-8-4-6-10-18(15)23(19(16)20(24)25)13-14-7-3-5-9-17(14)21/h3-10,22H,2,11-13H2,1H3,(H,24,25) |
| InChIKey | QMKBYQJVDWDEEA-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|