C28H37N3O2 — CID 92667596
3-[[3-[(3R,5S)-3,5-dimethylpiperidin-1-yl]propylamino]methyl]-1-[(2-methylphenyl)methyl]indole-2-carboxylic acid (PubChem CID 92667596) has the molecular formula C28H37N3O2 and a molecular weight of 447.62 g/mol. Its IUPAC name is 3-[[3-[(3R,5S)-3,5-dimethylpiperidin-1-yl]propylamino]methyl]-1-[(2-methylphenyl)methyl]indole-2-carboxylic acid.
| Compound Name | 3-[[3-[(3R,5S)-3,5-dimethylpiperidin-1-yl]propylamino]methyl]-1-[(2-methylphenyl)methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 92667596 |
| Molecular Formula | C28H37N3O2 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.29 |
| IUPAC Name | 3-[[3-[(3R,5S)-3,5-dimethylpiperidin-1-yl]propylamino]methyl]-1-[(2-methylphenyl)methyl]indole-2-carboxylic acid |
| SMILES | Cc1ccccc1Cn1c(C(=O)O)c(CNCCCN2C[C@H](C)C[C@H](C)C2)c2ccccc21 |
| InChI | InChI=1S/C28H37N3O2/c1-20-15-21(2)18-30(17-20)14-8-13-29-16-25-24-11-6-7-12-26(24)31(27(25)28(32)33)19-23-10-5-4-9-22(23)3/h4-7,9-12,20-21,29H,8,13-19H2,1-3H3,(H,32,33)/t20-,21+ |
| InChIKey | LWDUZZAKICUPMH-OYRHEFFESA-N |
| XLogP | 5.15 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|