C30H34N2O5 — CID 53209104
6-methyl-1-[(2-methylphenyl)methyl]-3-[[2-(2,3,4-trimethoxyphenyl)ethylamino]methyl]indole-2-carboxylic acid (PubChem CID 53209104) has the molecular formula C30H34N2O5 and a molecular weight of 502.61 g/mol. Its IUPAC name is 6-methyl-1-[(2-methylphenyl)methyl]-3-[[2-(2,3,4-trimethoxyphenyl)ethylamino]methyl]indole-2-carboxylic acid.
| Compound Name | 6-methyl-1-[(2-methylphenyl)methyl]-3-[[2-(2,3,4-trimethoxyphenyl)ethylamino]methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 53209104 |
| Molecular Formula | C30H34N2O5 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | 6-methyl-1-[(2-methylphenyl)methyl]-3-[[2-(2,3,4-trimethoxyphenyl)ethylamino]methyl]indole-2-carboxylic acid |
| SMILES | COc1ccc(CCNCc2c(C(=O)O)n(Cc3ccccc3C)c3cc(C)ccc23)c(OC)c1OC |
| InChI | InChI=1S/C30H34N2O5/c1-19-10-12-23-24(17-31-15-14-21-11-13-26(35-3)29(37-5)28(21)36-4)27(30(33)34)32(25(23)16-19)18-22-9-7-6-8-20(22)2/h6-13,16,31H,14-15,17-18H2,1-5H3,(H,33,34) |
| InChIKey | USOOCXOAIZTGEN-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|