C29H32N2O5 — CID 53209095
6-methyl-1-[(2-methylphenyl)methyl]-3-[[(3,4,5-trimethoxyphenyl)methylamino]methyl]indole-2-carboxylic acid (PubChem CID 53209095) has the molecular formula C29H32N2O5 and a molecular weight of 488.58 g/mol. Its IUPAC name is 6-methyl-1-[(2-methylphenyl)methyl]-3-[[(3,4,5-trimethoxyphenyl)methylamino]methyl]indole-2-carboxylic acid.
| Compound Name | 6-methyl-1-[(2-methylphenyl)methyl]-3-[[(3,4,5-trimethoxyphenyl)methylamino]methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 53209095 |
| Molecular Formula | C29H32N2O5 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | 6-methyl-1-[(2-methylphenyl)methyl]-3-[[(3,4,5-trimethoxyphenyl)methylamino]methyl]indole-2-carboxylic acid |
| SMILES | COc1cc(CNCc2c(C(=O)O)n(Cc3ccccc3C)c3cc(C)ccc23)cc(OC)c1OC |
| InChI | InChI=1S/C29H32N2O5/c1-18-10-11-22-23(16-30-15-20-13-25(34-3)28(36-5)26(14-20)35-4)27(29(32)33)31(24(22)12-18)17-21-9-7-6-8-19(21)2/h6-14,30H,15-17H2,1-5H3,(H,32,33) |
| InChIKey | FWRYMSBNPVLHCW-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|