C28H30N2O5 — CID 53208595
3-[[(2,5-dimethoxyphenyl)methylamino]methyl]-6-methoxy-1-[(4-methylphenyl)methyl]indole-2-carboxylic acid (PubChem CID 53208595) has the molecular formula C28H30N2O5 and a molecular weight of 474.56 g/mol. Its IUPAC name is 3-[[(2,5-dimethoxyphenyl)methylamino]methyl]-6-methoxy-1-[(4-methylphenyl)methyl]indole-2-carboxylic acid.
| Compound Name | 3-[[(2,5-dimethoxyphenyl)methylamino]methyl]-6-methoxy-1-[(4-methylphenyl)methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 53208595 |
| Molecular Formula | C28H30N2O5 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | 3-[[(2,5-dimethoxyphenyl)methylamino]methyl]-6-methoxy-1-[(4-methylphenyl)methyl]indole-2-carboxylic acid |
| SMILES | COc1ccc(OC)c(CNCc2c(C(=O)O)n(Cc3ccc(C)cc3)c3cc(OC)ccc23)c1 |
| InChI | InChI=1S/C28H30N2O5/c1-18-5-7-19(8-6-18)17-30-25-14-22(34-3)9-11-23(25)24(27(30)28(31)32)16-29-15-20-13-21(33-2)10-12-26(20)35-4/h5-14,29H,15-17H2,1-4H3,(H,31,32) |
| InChIKey | ZPCKYECPUNMXRK-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|