C27H27FN2O4 — CID 53208630
3-[[(2-ethoxyphenyl)methylamino]methyl]-1-[(4-fluorophenyl)methyl]-6-methoxyindole-2-carboxylic acid (PubChem CID 53208630) has the molecular formula C27H27FN2O4 and a molecular weight of 462.52 g/mol. Its IUPAC name is 3-[[(2-ethoxyphenyl)methylamino]methyl]-1-[(4-fluorophenyl)methyl]-6-methoxyindole-2-carboxylic acid.
| Compound Name | 3-[[(2-ethoxyphenyl)methylamino]methyl]-1-[(4-fluorophenyl)methyl]-6-methoxyindole-2-carboxylic acid |
|---|---|
| PubChem CID | 53208630 |
| Molecular Formula | C27H27FN2O4 |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 3-[[(2-ethoxyphenyl)methylamino]methyl]-1-[(4-fluorophenyl)methyl]-6-methoxyindole-2-carboxylic acid |
| SMILES | CCOc1ccccc1CNCc1c(C(=O)O)n(Cc2ccc(F)cc2)c2cc(OC)ccc12 |
| InChI | InChI=1S/C27H27FN2O4/c1-3-34-25-7-5-4-6-19(25)15-29-16-23-22-13-12-21(33-2)14-24(22)30(26(23)27(31)32)17-18-8-10-20(28)11-9-18/h4-14,29H,3,15-17H2,1-2H3,(H,31,32) |
| InChIKey | NUKLRDMONZCNCI-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|