C26H24ClFN2O3 — CID 53208511
1-[(2-chloro-4-fluorophenyl)methyl]-6-methoxy-3-[[(4-methylphenyl)methylamino]methyl]indole-2-carboxylic acid (PubChem CID 53208511) has the molecular formula C26H24ClFN2O3 and a molecular weight of 466.94 g/mol. Its IUPAC name is 1-[(2-chloro-4-fluorophenyl)methyl]-6-methoxy-3-[[(4-methylphenyl)methylamino]methyl]indole-2-carboxylic acid.
| Compound Name | 1-[(2-chloro-4-fluorophenyl)methyl]-6-methoxy-3-[[(4-methylphenyl)methylamino]methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 53208511 |
| Molecular Formula | C26H24ClFN2O3 |
| Molecular Weight | 466.94 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | 1-[(2-chloro-4-fluorophenyl)methyl]-6-methoxy-3-[[(4-methylphenyl)methylamino]methyl]indole-2-carboxylic acid |
| SMILES | COc1ccc2c(CNCc3ccc(C)cc3)c(C(=O)O)n(Cc3ccc(F)cc3Cl)c2c1 |
| InChI | InChI=1S/C26H24ClFN2O3/c1-16-3-5-17(6-4-16)13-29-14-22-21-10-9-20(33-2)12-24(21)30(25(22)26(31)32)15-18-7-8-19(28)11-23(18)27/h3-12,29H,13-15H2,1-2H3,(H,31,32) |
| InChIKey | DQDQMAWDPXSJAJ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.94 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|