C28H25ClFN3O3 — CID 53209069
1-[(2-chloro-4-fluorophenyl)methyl]-3-[[2-(1H-indol-3-yl)ethylamino]methyl]-6-methoxyindole-2-carboxylic acid (PubChem CID 53209069) has the molecular formula C28H25ClFN3O3 and a molecular weight of 505.98 g/mol. Its IUPAC name is 1-[(2-chloro-4-fluorophenyl)methyl]-3-[[2-(1H-indol-3-yl)ethylamino]methyl]-6-methoxyindole-2-carboxylic acid.
| Compound Name | 1-[(2-chloro-4-fluorophenyl)methyl]-3-[[2-(1H-indol-3-yl)ethylamino]methyl]-6-methoxyindole-2-carboxylic acid |
|---|---|
| PubChem CID | 53209069 |
| Molecular Formula | C28H25ClFN3O3 |
| Molecular Weight | 505.98 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | 1-[(2-chloro-4-fluorophenyl)methyl]-3-[[2-(1H-indol-3-yl)ethylamino]methyl]-6-methoxyindole-2-carboxylic acid |
| SMILES | COc1ccc2c(CNCCc3c[nH]c4ccccc34)c(C(=O)O)n(Cc3ccc(F)cc3Cl)c2c1 |
| InChI | InChI=1S/C28H25ClFN3O3/c1-36-20-8-9-22-23(15-31-11-10-17-14-32-25-5-3-2-4-21(17)25)27(28(34)35)33(26(22)13-20)16-18-6-7-19(30)12-24(18)29/h2-9,12-14,31-32H,10-11,15-16H2,1H3,(H,34,35) |
| InChIKey | UYWHYHOXRGEEHG-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 79.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.98 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|