C27H28N2O3S — CID 53208663
1-benzyl-6-methoxy-3-[[2-(4-methylsulfanylphenyl)ethylamino]methyl]indole-2-carboxylic acid (PubChem CID 53208663) has the molecular formula C27H28N2O3S and a molecular weight of 460.60 g/mol. Its IUPAC name is 1-benzyl-6-methoxy-3-[[2-(4-methylsulfanylphenyl)ethylamino]methyl]indole-2-carboxylic acid.
| Compound Name | 1-benzyl-6-methoxy-3-[[2-(4-methylsulfanylphenyl)ethylamino]methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 53208663 |
| Molecular Formula | C27H28N2O3S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 1-benzyl-6-methoxy-3-[[2-(4-methylsulfanylphenyl)ethylamino]methyl]indole-2-carboxylic acid |
| SMILES | COc1ccc2c(CNCCc3ccc(SC)cc3)c(C(=O)O)n(Cc3ccccc3)c2c1 |
| InChI | InChI=1S/C27H28N2O3S/c1-32-21-10-13-23-24(17-28-15-14-19-8-11-22(33-2)12-9-19)26(27(30)31)29(25(23)16-21)18-20-6-4-3-5-7-20/h3-13,16,28H,14-15,17-18H2,1-2H3,(H,30,31) |
| InChIKey | SEXWQVYTSQGWBG-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|