C26H26N2O4 — CID 53208370
1-[(4-methoxyphenyl)methyl]-3-[[(3-methoxyphenyl)methylamino]methyl]indole-2-carboxylic acid (PubChem CID 53208370) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-3-[[(3-methoxyphenyl)methylamino]methyl]indole-2-carboxylic acid.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-3-[[(3-methoxyphenyl)methylamino]methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 53208370 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-3-[[(3-methoxyphenyl)methylamino]methyl]indole-2-carboxylic acid |
| SMILES | COc1ccc(Cn2c(C(=O)O)c(CNCc3cccc(OC)c3)c3ccccc32)cc1 |
| InChI | InChI=1S/C26H26N2O4/c1-31-20-12-10-18(11-13-20)17-28-24-9-4-3-8-22(24)23(25(28)26(29)30)16-27-15-19-6-5-7-21(14-19)32-2/h3-14,27H,15-17H2,1-2H3,(H,29,30) |
| InChIKey | VWPAZXNIUZCWNY-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|