C25H23ClN2O3 — CID 53207253
1-[(4-chlorophenyl)methyl]-3-[[(4-methoxyphenyl)methylamino]methyl]indole-2-carboxylic acid (PubChem CID 53207253) has the molecular formula C25H23ClN2O3 and a molecular weight of 434.92 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-[[(4-methoxyphenyl)methylamino]methyl]indole-2-carboxylic acid.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-[[(4-methoxyphenyl)methylamino]methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 53207253 |
| Molecular Formula | C25H23ClN2O3 |
| Molecular Weight | 434.92 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-[[(4-methoxyphenyl)methylamino]methyl]indole-2-carboxylic acid |
| SMILES | COc1ccc(CNCc2c(C(=O)O)n(Cc3ccc(Cl)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C25H23ClN2O3/c1-31-20-12-8-17(9-13-20)14-27-15-22-21-4-2-3-5-23(21)28(24(22)25(29)30)16-18-6-10-19(26)11-7-18/h2-13,27H,14-16H2,1H3,(H,29,30) |
| InChIKey | BHHBOSJYIATORD-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.92 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|