C26H23ClN2O2 — CID 53207354
3-[[(4-chlorophenyl)methylamino]methyl]-1-[(4-ethenylphenyl)methyl]indole-2-carboxylic acid (PubChem CID 53207354) has the molecular formula C26H23ClN2O2 and a molecular weight of 430.94 g/mol. Its IUPAC name is 3-[[(4-chlorophenyl)methylamino]methyl]-1-[(4-ethenylphenyl)methyl]indole-2-carboxylic acid.
| Compound Name | 3-[[(4-chlorophenyl)methylamino]methyl]-1-[(4-ethenylphenyl)methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 53207354 |
| Molecular Formula | C26H23ClN2O2 |
| Molecular Weight | 430.94 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 3-[[(4-chlorophenyl)methylamino]methyl]-1-[(4-ethenylphenyl)methyl]indole-2-carboxylic acid |
| SMILES | C=Cc1ccc(Cn2c(C(=O)O)c(CNCc3ccc(Cl)cc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C26H23ClN2O2/c1-2-18-7-9-20(10-8-18)17-29-24-6-4-3-5-22(24)23(25(29)26(30)31)16-28-15-19-11-13-21(27)14-12-19/h2-14,28H,1,15-17H2,(H,30,31) |
| InChIKey | SIOGBMXQHSWFBR-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.94 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|