C25H29ClN2O2 — CID 98766532
1-[(4-chlorophenyl)methyl]-3-[[[(1R,2S,3R)-2,3-dimethylcyclohexyl]amino]methyl]indole-2-carboxylic acid (PubChem CID 98766532) has the molecular formula C25H29ClN2O2 and a molecular weight of 424.97 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-[[[(1R,2S,3R)-2,3-dimethylcyclohexyl]amino]methyl]indole-2-carboxylic acid.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-[[[(1R,2S,3R)-2,3-dimethylcyclohexyl]amino]methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 98766532 |
| Molecular Formula | C25H29ClN2O2 |
| Molecular Weight | 424.97 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-[[[(1R,2S,3R)-2,3-dimethylcyclohexyl]amino]methyl]indole-2-carboxylic acid |
| SMILES | C[C@H]1[C@H](C)CCC[C@H]1NCc1c(C(=O)O)n(Cc2ccc(Cl)cc2)c2ccccc12 |
| InChI | InChI=1S/C25H29ClN2O2/c1-16-6-5-8-22(17(16)2)27-14-21-20-7-3-4-9-23(20)28(24(21)25(29)30)15-18-10-12-19(26)13-11-18/h3-4,7,9-13,16-17,22,27H,5-6,8,14-15H2,1-2H3,(H,29,30)/t16-,17+,22-/m1/s1 |
| InChIKey | LOURYDCJDKMJNK-HYFFOGBASA-N |
| XLogP | 5.96 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.97 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|