C26H32N2O2 — CID 53207169
3-[[(2,3-dimethylcyclohexyl)amino]methyl]-1-[(4-methylphenyl)methyl]indole-2-carboxylic acid (PubChem CID 53207169) has the molecular formula C26H32N2O2 and a molecular weight of 404.55 g/mol. Its IUPAC name is 3-[[(2,3-dimethylcyclohexyl)amino]methyl]-1-[(4-methylphenyl)methyl]indole-2-carboxylic acid.
| Compound Name | 3-[[(2,3-dimethylcyclohexyl)amino]methyl]-1-[(4-methylphenyl)methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 53207169 |
| Molecular Formula | C26H32N2O2 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | 3-[[(2,3-dimethylcyclohexyl)amino]methyl]-1-[(4-methylphenyl)methyl]indole-2-carboxylic acid |
| SMILES | Cc1ccc(Cn2c(C(=O)O)c(CNC3CCCC(C)C3C)c3ccccc32)cc1 |
| InChI | InChI=1S/C26H32N2O2/c1-17-11-13-20(14-12-17)16-28-24-10-5-4-8-21(24)22(25(28)26(29)30)15-27-23-9-6-7-18(2)19(23)3/h4-5,8,10-14,18-19,23,27H,6-7,9,15-16H2,1-3H3,(H,29,30) |
| InChIKey | BPOZBHDFRQVEKO-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|