C25H26N4O3S2 — CID 156746163
3-[(cyclobutylamino)methyl]-1-[(4-methylphenyl)methyl]-N-(1,3-thiazol-2-ylsulfonyl)indole-2-carboxamide (PubChem CID 156746163) has the molecular formula C25H26N4O3S2 and a molecular weight of 494.64 g/mol. Its IUPAC name is 3-[(cyclobutylamino)methyl]-1-[(4-methylphenyl)methyl]-N-(1,3-thiazol-2-ylsulfonyl)indole-2-carboxamide.
| Compound Name | 3-[(cyclobutylamino)methyl]-1-[(4-methylphenyl)methyl]-N-(1,3-thiazol-2-ylsulfonyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 156746163 |
| Molecular Formula | C25H26N4O3S2 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | 3-[(cyclobutylamino)methyl]-1-[(4-methylphenyl)methyl]-N-(1,3-thiazol-2-ylsulfonyl)indole-2-carboxamide |
| SMILES | Cc1ccc(Cn2c(C(=O)NS(=O)(=O)c3nccs3)c(CNC3CCC3)c3ccccc32)cc1 |
| InChI | InChI=1S/C25H26N4O3S2/c1-17-9-11-18(12-10-17)16-29-22-8-3-2-7-20(22)21(15-27-19-5-4-6-19)23(29)24(30)28-34(31,32)25-26-13-14-33-25/h2-3,7-14,19,27H,4-6,15-16H2,1H3,(H,28,30) |
| InChIKey | VAZLLJVLDVXVRZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|