C27H29N3OS — CID 71843816
1-[(1-benzyl-2-thiophen-2-ylindol-3-yl)methyl]-3-cyclohexylurea (PubChem CID 71843816) has the molecular formula C27H29N3OS and a molecular weight of 443.62 g/mol. Its IUPAC name is 1-[(1-benzyl-2-thiophen-2-ylindol-3-yl)methyl]-3-cyclohexylurea.
| Compound Name | 1-[(1-benzyl-2-thiophen-2-ylindol-3-yl)methyl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 71843816 |
| Molecular Formula | C27H29N3OS |
| Molecular Weight | 443.62 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 1-[(1-benzyl-2-thiophen-2-ylindol-3-yl)methyl]-3-cyclohexylurea |
| SMILES | O=C(NCc1c(-c2cccs2)n(Cc2ccccc2)c2ccccc12)NC1CCCCC1 |
| InChI | InChI=1S/C27H29N3OS/c31-27(29-21-12-5-2-6-13-21)28-18-23-22-14-7-8-15-24(22)30(19-20-10-3-1-4-11-20)26(23)25-16-9-17-32-25/h1,3-4,7-11,14-17,21H,2,5-6,12-13,18-19H2,(H2,28,29,31) |
| InChIKey | LIQZUEANHGQIKL-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.62 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|