C27H22FN3OS — CID 53049817
1-[(1-benzyl-2-thiophen-2-ylindol-3-yl)methyl]-3-(4-fluorophenyl)urea (PubChem CID 53049817) has the molecular formula C27H22FN3OS and a molecular weight of 455.56 g/mol. Its IUPAC name is 1-[(1-benzyl-2-thiophen-2-ylindol-3-yl)methyl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[(1-benzyl-2-thiophen-2-ylindol-3-yl)methyl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 53049817 |
| Molecular Formula | C27H22FN3OS |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 1-[(1-benzyl-2-thiophen-2-ylindol-3-yl)methyl]-3-(4-fluorophenyl)urea |
| SMILES | O=C(NCc1c(-c2cccs2)n(Cc2ccccc2)c2ccccc12)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C27H22FN3OS/c28-20-12-14-21(15-13-20)30-27(32)29-17-23-22-9-4-5-10-24(22)31(18-19-7-2-1-3-8-19)26(23)25-11-6-16-33-25/h1-16H,17-18H2,(H2,29,30,32) |
| InChIKey | ATLHPGRCMDUFMO-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|