C23H23N3OS — CID 71843856
1-[(1-ethyl-2-thiophen-2-ylindol-3-yl)methyl]-3-(3-methylphenyl)urea (PubChem CID 71843856) has the molecular formula C23H23N3OS and a molecular weight of 389.52 g/mol. Its IUPAC name is 1-[(1-ethyl-2-thiophen-2-ylindol-3-yl)methyl]-3-(3-methylphenyl)urea.
| Compound Name | 1-[(1-ethyl-2-thiophen-2-ylindol-3-yl)methyl]-3-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 71843856 |
| Molecular Formula | C23H23N3OS |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 1-[(1-ethyl-2-thiophen-2-ylindol-3-yl)methyl]-3-(3-methylphenyl)urea |
| SMILES | CCn1c(-c2cccs2)c(CNC(=O)Nc2cccc(C)c2)c2ccccc21 |
| InChI | InChI=1S/C23H23N3OS/c1-3-26-20-11-5-4-10-18(20)19(22(26)21-12-7-13-28-21)15-24-23(27)25-17-9-6-8-16(2)14-17/h4-14H,3,15H2,1-2H3,(H2,24,25,27) |
| InChIKey | OLVKWGJFGLSIRO-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|