C28H24ClN3OS — CID 53049813
1-[(1-benzyl-2-thiophen-2-ylindol-3-yl)methyl]-3-(3-chloro-2-methylphenyl)urea (PubChem CID 53049813) has the molecular formula C28H24ClN3OS and a molecular weight of 486.04 g/mol. Its IUPAC name is 1-[(1-benzyl-2-thiophen-2-ylindol-3-yl)methyl]-3-(3-chloro-2-methylphenyl)urea.
| Compound Name | 1-[(1-benzyl-2-thiophen-2-ylindol-3-yl)methyl]-3-(3-chloro-2-methylphenyl)urea |
|---|---|
| PubChem CID | 53049813 |
| Molecular Formula | C28H24ClN3OS |
| Molecular Weight | 486.04 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 1-[(1-benzyl-2-thiophen-2-ylindol-3-yl)methyl]-3-(3-chloro-2-methylphenyl)urea |
| SMILES | Cc1c(Cl)cccc1NC(=O)NCc1c(-c2cccs2)n(Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C28H24ClN3OS/c1-19-23(29)12-7-13-24(19)31-28(33)30-17-22-21-11-5-6-14-25(21)32(18-20-9-3-2-4-10-20)27(22)26-15-8-16-34-26/h2-16H,17-18H2,1H3,(H2,30,31,33) |
| InChIKey | UYXGBIIUHSGCLI-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.04 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|