C23H22ClN3O3S — CID 71843915
1-(5-chloro-2,4-dimethoxyphenyl)-3-[(1-methyl-2-thiophen-2-ylindol-3-yl)methyl]urea (PubChem CID 71843915) has the molecular formula C23H22ClN3O3S and a molecular weight of 455.97 g/mol. Its IUPAC name is 1-(5-chloro-2,4-dimethoxyphenyl)-3-[(1-methyl-2-thiophen-2-ylindol-3-yl)methyl]urea.
| Compound Name | 1-(5-chloro-2,4-dimethoxyphenyl)-3-[(1-methyl-2-thiophen-2-ylindol-3-yl)methyl]urea |
|---|---|
| PubChem CID | 71843915 |
| Molecular Formula | C23H22ClN3O3S |
| Molecular Weight | 455.97 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 1-(5-chloro-2,4-dimethoxyphenyl)-3-[(1-methyl-2-thiophen-2-ylindol-3-yl)methyl]urea |
| SMILES | COc1cc(OC)c(NC(=O)NCc2c(-c3cccs3)n(C)c3ccccc23)cc1Cl |
| InChI | InChI=1S/C23H22ClN3O3S/c1-27-18-8-5-4-7-14(18)15(22(27)21-9-6-10-31-21)13-25-23(28)26-17-11-16(24)19(29-2)12-20(17)30-3/h4-12H,13H2,1-3H3,(H2,25,26,28) |
| InChIKey | IUYGFQKEVIIHLS-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.97 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|