C26H27N3O3S — CID 95063417
ethyl (3R)-3-[(1-methyl-2-thiophen-2-ylindol-3-yl)methylcarbamoylamino]-3-phenylpropanoate (PubChem CID 95063417) has the molecular formula C26H27N3O3S and a molecular weight of 461.59 g/mol. Its IUPAC name is ethyl (3R)-3-[(1-methyl-2-thiophen-2-ylindol-3-yl)methylcarbamoylamino]-3-phenylpropanoate.
| Compound Name | ethyl (3R)-3-[(1-methyl-2-thiophen-2-ylindol-3-yl)methylcarbamoylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 95063417 |
| Molecular Formula | C26H27N3O3S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | ethyl (3R)-3-[(1-methyl-2-thiophen-2-ylindol-3-yl)methylcarbamoylamino]-3-phenylpropanoate |
| SMILES | CCOC(=O)C[C@@H](NC(=O)NCc1c(-c2cccs2)n(C)c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C26H27N3O3S/c1-3-32-24(30)16-21(18-10-5-4-6-11-18)28-26(31)27-17-20-19-12-7-8-13-22(19)29(2)25(20)23-14-9-15-33-23/h4-15,21H,3,16-17H2,1-2H3,(H2,27,28,31)/t21-/m1/s1 |
| InChIKey | YEIKHJYPPXUNJW-OAQYLSRUSA-N |
| XLogP | 5.40 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|