C22H28N4O3S — CID 50830179
ethyl 3-phenyl-3-[(2-thiomorpholin-4-yl-4-pyridinyl)methylcarbamoylamino]propanoate (PubChem CID 50830179) has the molecular formula C22H28N4O3S and a molecular weight of 428.56 g/mol. Its IUPAC name is ethyl 3-phenyl-3-[(2-thiomorpholin-4-yl-4-pyridinyl)methylcarbamoylamino]propanoate.
| Compound Name | ethyl 3-phenyl-3-[(2-thiomorpholin-4-yl-4-pyridinyl)methylcarbamoylamino]propanoate |
|---|---|
| PubChem CID | 50830179 |
| Molecular Formula | C22H28N4O3S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | ethyl 3-phenyl-3-[(2-thiomorpholin-4-yl-4-pyridinyl)methylcarbamoylamino]propanoate |
| SMILES | CCOC(=O)CC(NC(=O)NCc1ccnc(N2CCSCC2)c1)c1ccccc1 |
| InChI | InChI=1S/C22H28N4O3S/c1-2-29-21(27)15-19(18-6-4-3-5-7-18)25-22(28)24-16-17-8-9-23-20(14-17)26-10-12-30-13-11-26/h3-9,14,19H,2,10-13,15-16H2,1H3,(H2,24,25,28) |
| InChIKey | HRFFFXQRAHTXBQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |