C21H28N4O — CID 42954515
1-(4-phenylbutan-2-yl)-3-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]urea (PubChem CID 42954515) has the molecular formula C21H28N4O and a molecular weight of 352.48 g/mol. Its IUPAC name is 1-(4-phenylbutan-2-yl)-3-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]urea.
| Compound Name | 1-(4-phenylbutan-2-yl)-3-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 42954515 |
| Molecular Formula | C21H28N4O |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | 1-(4-phenylbutan-2-yl)-3-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]urea |
| SMILES | CC(CCc1ccccc1)NC(=O)NCc1ccnc(N2CCCC2)c1 |
| InChI | InChI=1S/C21H28N4O/c1-17(9-10-18-7-3-2-4-8-18)24-21(26)23-16-19-11-12-22-20(15-19)25-13-5-6-14-25/h2-4,7-8,11-12,15,17H,5-6,9-10,13-14,16H2,1H3,(H2,23,24,26) |
| InChIKey | VUTIOXSQFONPEG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |