C17H28N4O2 — CID 111504417
1-(1-hydroxy-4-methylpentan-3-yl)-3-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]urea (PubChem CID 111504417) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 1-(1-hydroxy-4-methylpentan-3-yl)-3-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]urea.
| Compound Name | 1-(1-hydroxy-4-methylpentan-3-yl)-3-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 111504417 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 1-(1-hydroxy-4-methylpentan-3-yl)-3-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]urea |
| SMILES | CC(C)C(CCO)NC(=O)NCc1ccnc(N2CCCC2)c1 |
| InChI | InChI=1S/C17H28N4O2/c1-13(2)15(6-10-22)20-17(23)19-12-14-5-7-18-16(11-14)21-8-3-4-9-21/h5,7,11,13,15,22H,3-4,6,8-10,12H2,1-2H3,(H2,19,20,23) |
| InChIKey | OJTIMGQEQFWJRY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |