C18H30N4O2 — CID 110028346
1-(1-hydroxy-4-methylpentan-3-yl)-3-[(6-methyl-2-pyrrolidin-1-yl-3-pyridinyl)methyl]urea (PubChem CID 110028346) has the molecular formula C18H30N4O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is 1-(1-hydroxy-4-methylpentan-3-yl)-3-[(6-methyl-2-pyrrolidin-1-yl-3-pyridinyl)methyl]urea.
| Compound Name | 1-(1-hydroxy-4-methylpentan-3-yl)-3-[(6-methyl-2-pyrrolidin-1-yl-3-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 110028346 |
| Molecular Formula | C18H30N4O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | 1-(1-hydroxy-4-methylpentan-3-yl)-3-[(6-methyl-2-pyrrolidin-1-yl-3-pyridinyl)methyl]urea |
| SMILES | Cc1ccc(CNC(=O)NC(CCO)C(C)C)c(N2CCCC2)n1 |
| InChI | InChI=1S/C18H30N4O2/c1-13(2)16(8-11-23)21-18(24)19-12-15-7-6-14(3)20-17(15)22-9-4-5-10-22/h6-7,13,16,23H,4-5,8-12H2,1-3H3,(H2,19,21,24) |
| InChIKey | NAMOEPQFGUIVIT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |