C14H23N3S — CID 62281237
2-methyl-N-[(2-thiomorpholin-4-yl-4-pyridinyl)methyl]propan-2-amine (PubChem CID 62281237) has the molecular formula C14H23N3S and a molecular weight of 265.43 g/mol. Its IUPAC name is 2-methyl-N-[(2-thiomorpholin-4-yl-4-pyridinyl)methyl]propan-2-amine.
| Compound Name | 2-methyl-N-[(2-thiomorpholin-4-yl-4-pyridinyl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 62281237 |
| Molecular Formula | C14H23N3S |
| Molecular Weight | 265.43 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 2-methyl-N-[(2-thiomorpholin-4-yl-4-pyridinyl)methyl]propan-2-amine |
| SMILES | CC(C)(C)NCc1ccnc(N2CCSCC2)c1 |
| InChI | InChI=1S/C14H23N3S/c1-14(2,3)16-11-12-4-5-15-13(10-12)17-6-8-18-9-7-17/h4-5,10,16H,6-9,11H2,1-3H3 |
| InChIKey | LOWVARPLLLFBLC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |