C16H25FN2S — CID 63060084
N-[[3-fluoro-4-(1,4-thiazepan-4-yl)phenyl]methyl]-2-methylpropan-2-amine (PubChem CID 63060084) has the molecular formula C16H25FN2S and a molecular weight of 296.45 g/mol. Its IUPAC name is N-[[3-fluoro-4-(1,4-thiazepan-4-yl)phenyl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[3-fluoro-4-(1,4-thiazepan-4-yl)phenyl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 63060084 |
| Molecular Formula | C16H25FN2S |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | N-[[3-fluoro-4-(1,4-thiazepan-4-yl)phenyl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCc1ccc(N2CCCSCC2)c(F)c1 |
| InChI | InChI=1S/C16H25FN2S/c1-16(2,3)18-12-13-5-6-15(14(17)11-13)19-7-4-9-20-10-8-19/h5-6,11,18H,4,7-10,12H2,1-3H3 |
| InChIKey | AZDFRNJJVXOJPF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|