C19H24N4OS — CID 50830146
1-(2-ethylphenyl)-3-[(2-thiomorpholin-4-yl-4-pyridinyl)methyl]urea (PubChem CID 50830146) has the molecular formula C19H24N4OS and a molecular weight of 356.50 g/mol. Its IUPAC name is 1-(2-ethylphenyl)-3-[(2-thiomorpholin-4-yl-4-pyridinyl)methyl]urea.
| Compound Name | 1-(2-ethylphenyl)-3-[(2-thiomorpholin-4-yl-4-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 50830146 |
| Molecular Formula | C19H24N4OS |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 1-(2-ethylphenyl)-3-[(2-thiomorpholin-4-yl-4-pyridinyl)methyl]urea |
| SMILES | CCc1ccccc1NC(=O)NCc1ccnc(N2CCSCC2)c1 |
| InChI | InChI=1S/C19H24N4OS/c1-2-16-5-3-4-6-17(16)22-19(24)21-14-15-7-8-20-18(13-15)23-9-11-25-12-10-23/h3-8,13H,2,9-12,14H2,1H3,(H2,21,22,24) |
| InChIKey | VOZHQDLCPHVBLR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |