C23H22ClN3O2S — CID 53049775
1-(5-chloro-2-methoxyphenyl)-3-[(1-ethyl-2-thiophen-2-ylindol-3-yl)methyl]urea (PubChem CID 53049775) has the molecular formula C23H22ClN3O2S and a molecular weight of 439.97 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-[(1-ethyl-2-thiophen-2-ylindol-3-yl)methyl]urea.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-[(1-ethyl-2-thiophen-2-ylindol-3-yl)methyl]urea |
|---|---|
| PubChem CID | 53049775 |
| Molecular Formula | C23H22ClN3O2S |
| Molecular Weight | 439.97 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-[(1-ethyl-2-thiophen-2-ylindol-3-yl)methyl]urea |
| SMILES | CCn1c(-c2cccs2)c(CNC(=O)Nc2cc(Cl)ccc2OC)c2ccccc21 |
| InChI | InChI=1S/C23H22ClN3O2S/c1-3-27-19-8-5-4-7-16(19)17(22(27)21-9-6-12-30-21)14-25-23(28)26-18-13-15(24)10-11-20(18)29-2/h4-13H,3,14H2,1-2H3,(H2,25,26,28) |
| InChIKey | ZDLNOLJCQUPXQT-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.97 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|